Products 1413927-31-7

CAS 1413927-31-7 is the registry number for 4-Fluoro-2,3-dimethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-fluoro-2,3-dimethoxybenzoic acid (CAS 1413927-31-7) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 4-fluoro-2,3-dimethoxybenzoic acid. InChIKey: OXDACUJNZQJKIE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4
Molecular weight200.16 g/mol
IUPAC name4-fluoro-2,3-dimethoxybenzoic acid
InChIKeyOXDACUJNZQJKIE-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1OC)F)C(=O)O

Computed by PubChem (NCBI)