Products 1785577-68-5

CAS 1785577-68-5 is the registry number for 2-(4-Fluoro-2-methoxyphenoxy)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-fluoro-2-methoxyphenoxy)acetic acid (CAS 1785577-68-5) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 2-(4-fluoro-2-methoxyphenoxy)acetic acid. InChIKey: BOEWAEIGPVUWLG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4
Molecular weight200.16 g/mol
IUPAC name2-(4-fluoro-2-methoxyphenoxy)acetic acid
InChIKeyBOEWAEIGPVUWLG-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)F)OCC(=O)O

Computed by PubChem (NCBI)