CAS 651734-59-7 appears in our catalog under these names: 2-Fluoro-3,5-dimethoxybenzoic acid, 95%, 2–Fluoro–3,5–dimethoxybenzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-fluoro-3,5-dimethoxybenzoic acid (CAS 651734-59-7) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 2-fluoro-3,5-dimethoxybenzoic acid. InChIKey: RJXGLFJDVUJJGM-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 2-fluoro-3,5-dimethoxybenzoic acid |
| InChIKey | RJXGLFJDVUJJGM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)F)C(=O)O |
Computed by PubChem (NCBI)