CAS 1214334-51-6 is the registry number for 4-(Difluoromethyl)-2-fluoro-1-nitrobenzene. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 2g, 5g.
4-(difluoromethyl)-2-fluoro-1-nitrobenzene (CAS 1214334-51-6) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 4-(difluoromethyl)-2-fluoro-1-nitrobenzene. InChIKey: AFFPEEJNSFMVRR-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-fluoro-1-nitrobenzene |
| InChIKey | AFFPEEJNSFMVRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)