CAS 1214364-90-5 appears in our catalog under these names: 1-(Difluoromethyl)-4-fluoro-2-nitrobenzene, 95%, 95%, 1-(Difluoromethyl)-4-fluoro-2-nitrobenzene, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(difluoromethyl)-4-fluoro-2-nitrobenzene (CAS 1214364-90-5) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 1-(difluoromethyl)-4-fluoro-2-nitrobenzene. InChIKey: JGLJIQJQYKADLK-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 1-(difluoromethyl)-4-fluoro-2-nitrobenzene |
| InChIKey | JGLJIQJQYKADLK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])C(F)F |
Computed by PubChem (NCBI)