CAS 1214373-68-8 is the registry number for 2,3,4,6-Tetrafluorophenylacetic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3,4,6-tetrafluorophenyl)acetic acid (CAS 1214373-68-8) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-(2,3,4,6-tetrafluorophenyl)acetic acid. InChIKey: RTDQRIRVSPMVNK-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-(2,3,4,6-tetrafluorophenyl)acetic acid |
| InChIKey | RTDQRIRVSPMVNK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)F)CC(=O)O)F |
Computed by PubChem (NCBI)