CAS 1541197-82-3 appears in our catalog under these names: 2-(3-Bromo-5-trifluoromethylphenyl)[1,3]dioxolane, 95%, 2-(3-Bromo-5-trifluoromethylphenyl)[1,3]dioxolane, ≥95%, 2-(3-Bromo-5-(trifluoromethyl)phenyl)-1,3-dioxolane, 98%, 2-(3-Bromo-5-trifluoromethylphenyl)[1,3]dioxolane, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-dioxolane (CAS 1541197-82-3) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: 2-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-dioxolane. InChIKey: WTVMIHPCQMLCHB-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | 2-[3-bromo-5-(trifluoromethyl)phenyl]-1,3-dioxolane |
| InChIKey | WTVMIHPCQMLCHB-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CC(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)