Products 1215206-05-5
CAS 1215206-05-5 is the registry number for 3'-Sulfamoylbiphenyl-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
3-(3-sulfamoylphenyl)benzoic acid (CAS 1215206-05-5) is a chemical compound with the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. IUPAC name: 3-(3-sulfamoylphenyl)benzoic acid. InChIKey: ICPJAUWCOLDBCW-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 3-(3-sulfamoylphenyl)benzoic acid |
| InChIKey | ICPJAUWCOLDBCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
3'-Sulfamoylbiphenyl-3-carboxylic acid, 3-(3-sulfamoylphenyl)benzoic acid, 3'-Sulfamoyl-[1,1'-biphenyl]-3-carboxylic acid, [1,1'-Biphenyl]-3-carboxylic acid, 3'-(aminosulfonyl)-, 3-Sulfamoylbiphenyl-3-carboxylic acid, 3''-Sulfamoylbiphenyl-3-carboxylic Acid, 3'-Sulfamoyl-[1,1'-biphenyl]-3-carboxylicacid