Products 6314-72-3
CAS 6314-72-3 appears in our catalog under these names: 4-Phenylsulfamoyl-benzoic acid, 95%, 4-(N-Phenylsulfamoyl)benzoic acid, 95%, 4-(Phenylsulfamoyl)benzoic acid, 4-PHENYLSULFAMOYL-BENZOIC ACID, 98%, 98%, 4-PHENYLSULFAMOYL-BENZOIC ACID, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 0,5g, 50mg.
4-(phenylsulfamoyl)benzoic acid (CAS 6314-72-3) is a chemical compound with the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. IUPAC name: 4-(phenylsulfamoyl)benzoic acid. InChIKey: BPLSJCLWJLIHTI-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 4-(phenylsulfamoyl)benzoic acid |
| InChIKey | BPLSJCLWJLIHTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)