CAS 248249-53-8 appears in our catalog under these names: 2-Benzo[1,3]dioxol-5-yl-thiazole-4-carboxylic acid ethyl ester, 95%, Ethyl 2-(benzo[d][1,3]dioxol-5-yl)thiazole-4-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10G, 1g, 250mg, 100mg.
Ethyl 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylate (CAS 248249-53-8) is a chemical compound with the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. IUPAC name: ethyl 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylate. InChIKey: WRDIRGFGEKHRIK-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | ethyl 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | WRDIRGFGEKHRIK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)