CAS 2248311-74-0 is the registry number for 1,3-Dioxoisoindolin-2-yl 1-(methylthio)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,3-dioxoisoindol-2-yl) 1-methylsulfanylcyclopropane-1-carboxylate (CAS 2248311-74-0) is a chemical compound with the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 1-methylsulfanylcyclopropane-1-carboxylate. InChIKey: NGDCSYWEHGMTRK-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 1-methylsulfanylcyclopropane-1-carboxylate |
| InChIKey | NGDCSYWEHGMTRK-UHFFFAOYSA-N |
| SMILES | CSC1(CC1)C(=O)ON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)