CAS 1576-45-0 appears in our catalog under these names: 3-(Anilinosulfonyl)benzenecarboxylic Acid, Belinostat Impurity 8, 3-(Anilinosulfonyl)-benzenecarboxylic Acid (3-ASBA), 3-(Phenylsulfamoyl)benzoic acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
3-(phenylsulfamoyl)benzoic acid (CAS 1576-45-0) is a chemical compound with the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. IUPAC name: 3-(phenylsulfamoyl)benzoic acid. InChIKey: YNRKZIPFWSDERE-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 3-(phenylsulfamoyl)benzoic acid |
| InChIKey | YNRKZIPFWSDERE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)