Products 1215206-25-9

CAS 1215206-25-9 is the registry number for 2'-Chloro-4'-methoxybiphenyl-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(2-chloro-4-methoxyphenyl)benzoic acid (CAS 1215206-25-9) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 3-(2-chloro-4-methoxyphenyl)benzoic acid. InChIKey: UQIHUVBRQAKJHD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO3
Molecular weight262.69 g/mol
IUPAC name3-(2-chloro-4-methoxyphenyl)benzoic acid
InChIKeyUQIHUVBRQAKJHD-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=CC(=CC=C2)C(=O)O)Cl

Computed by PubChem (NCBI)