Products 1215206-78-2

CAS 1215206-78-2 is the registry number for 2',3'-Dimethylbiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(2,3-dimethylphenyl)benzoic acid (CAS 1215206-78-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-(2,3-dimethylphenyl)benzoic acid. InChIKey: NZCHUDYYICLURF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O2
Molecular weight226.27 g/mol
IUPAC name3-(2,3-dimethylphenyl)benzoic acid
InChIKeyNZCHUDYYICLURF-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C2=CC(=CC=C2)C(=O)O)C

Computed by PubChem (NCBI)