Products 1215208-65-3
CAS 1215208-65-3 is the registry number for MPT0B214. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5-amino-6-methoxyquinolin-2-yl)-(3,4,5-trimethoxyphenyl)methanone (CAS 1215208-65-3) is a chemical compound with the molecular formula C20H20N2O5 and a molecular weight of 368.4 g/mol. IUPAC name: (5-amino-6-methoxyquinolin-2-yl)-(3,4,5-trimethoxyphenyl)methanone. InChIKey: HBQYPNDXFXSVNP-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O5 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (5-amino-6-methoxyquinolin-2-yl)-(3,4,5-trimethoxyphenyl)methanone |
| InChIKey | HBQYPNDXFXSVNP-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)N=C(C=C2)C(=O)C3=CC(=C(C(=C3)OC)OC)OC)N |
Computed by PubChem (NCBI)