CAS 1215669-56-9 is the registry number for S-Methyl-d3-thioacetaminophen. Offered by: TRC. Available pack sizes: 10mg, 1mg.
N-[4-hydroxy-3-(trideuteriomethylsulfanyl)phenyl]acetamide (CAS 1215669-56-9) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 200.27 g/mol. IUPAC name: N-[4-hydroxy-3-(trideuteriomethylsulfanyl)phenyl]acetamide. InChIKey: KNDKLDWGYWQCCJ-BMSJAHLVSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 200.27 g/mol |
| IUPAC name | N-[4-hydroxy-3-(trideuteriomethylsulfanyl)phenyl]acetamide |
| InChIKey | KNDKLDWGYWQCCJ-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])SC1=C(C=CC(=C1)NC(=O)C)O |
Computed by PubChem (NCBI)