Products 1215842-75-3
CAS 1215842-75-3 appears in our catalog under these names: rac-Cotinine-13C,d3, 1-Methyl-5-(3-pyridinyl)-2-pyrrolidinone-13C,d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
5-pyridin-3-yl-1-(trideuterio(113C)methyl)pyrrolidin-2-one (CAS 1215842-75-3) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 180.23 g/mol. IUPAC name: 5-pyridin-3-yl-1-(trideuterio(113C)methyl)pyrrolidin-2-one. InChIKey: UIKROCXWUNQSPJ-KQORAOOSSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | 5-pyridin-3-yl-1-(trideuterio(113C)methyl)pyrrolidin-2-one |
| InChIKey | UIKROCXWUNQSPJ-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])N1C(CCC1=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)