CAS 2241872-22-8 is the registry number for (Rac)-Cotinine-d7. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
5-(2,4,5,6-tetradeuterio-3-pyridinyl)-1-(trideuteriomethyl)pyrrolidin-2-one (CAS 2241872-22-8) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 183.26 g/mol. IUPAC name: 5-(2,4,5,6-tetradeuterio-3-pyridinyl)-1-(trideuteriomethyl)pyrrolidin-2-one. InChIKey: UIKROCXWUNQSPJ-QLEDRMQUSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 183.26 g/mol |
| IUPAC name | 5-(2,4,5,6-tetradeuterio-3-pyridinyl)-1-(trideuteriomethyl)pyrrolidin-2-one |
| InChIKey | UIKROCXWUNQSPJ-QLEDRMQUSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CCC(=O)N2C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)