CAS 66269-66-7 is the registry number for (+/-)-ortho-Cotinine-d3. Offered by: TRC. Available pack sizes: 25mg.
5-pyridin-3-yl-1-(trideuteriomethyl)pyrrolidin-2-one (CAS 66269-66-7) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 179.23 g/mol. IUPAC name: 5-pyridin-3-yl-1-(trideuteriomethyl)pyrrolidin-2-one. InChIKey: UIKROCXWUNQSPJ-FIBGUPNXSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | 5-pyridin-3-yl-1-(trideuteriomethyl)pyrrolidin-2-one |
| InChIKey | UIKROCXWUNQSPJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(CCC1=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)