CAS 1219375-49-1 is the registry number for 4-(1,3-Dioxotetrahydro-1h-pyrrolo[1,2-c]imidazol-2(3h)-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)benzoic acid (CAS 1219375-49-1) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)benzoic acid. InChIKey: QBZGUYIVQQJBHQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 4-(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)benzoic acid |
| InChIKey | QBZGUYIVQQJBHQ-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)N(C(=O)N2C1)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)