Products 1216237-38-5
CAS 1216237-38-5 is the registry number for {6,8-Dichloroimidazo(1,2-a)pyridin-2-yl}methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanamine (CAS 1216237-38-5) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanamine. InChIKey: MHCDDZYQRPQTLW-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | (6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methanamine |
| InChIKey | MHCDDZYQRPQTLW-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN2C=C1Cl)CN)Cl |
Computed by PubChem (NCBI)