CAS 4445-30-1 appears in our catalog under these names: 2-(2-Hydroxyphenyl)benzoic acid, dehydrate, 96%, 2'-Hydroxy-(1,1'-biphenyl)-2-carboxylic acid, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 5g, 1g, 250mg, 2,5g, 10g, 25g.
2-(2-hydroxyphenyl)benzoic acid (CAS 4445-30-1) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: 2-(2-hydroxyphenyl)benzoic acid. InChIKey: LTDWHGJBVJGQKY-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-(2-hydroxyphenyl)benzoic acid |
| InChIKey | LTDWHGJBVJGQKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2O)C(=O)O |
Computed by PubChem (NCBI)