CAS 1216459-54-9 appears in our catalog under these names: Ibuprofen-13C6, >95% (HPLC), Ibuprofen-13C6, Ibuprofen-13C6, 98.24%. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-[4-(2-methylpropyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]propanoic acid (CAS 1216459-54-9) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 212.24 g/mol. IUPAC name: 2-[4-(2-methylpropyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]propanoic acid. InChIKey: HEFNNWSXXWATRW-HNHUTNRMSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 2-[4-(2-methylpropyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]propanoic acid |
| InChIKey | HEFNNWSXXWATRW-HNHUTNRMSA-N |
| SMILES | CC(C)C[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C(C)C(=O)O |
Computed by PubChem (NCBI)