Products 1261394-40-4
CAS 1261394-40-4 appears in our catalog under these names: Ibuprofen-13C-d3, Ibuprofen-13C,d3, >95% (HPLC), Ibuprofen-13C,d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 1mg, 25mg, 5mg, 1 mg.
3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl](313C)propanoic acid (CAS 1261394-40-4) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 210.29 g/mol. IUPAC name: 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl](313C)propanoic acid. InChIKey: HEFNNWSXXWATRW-LBDFIVMYSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl](313C)propanoic acid |
| InChIKey | HEFNNWSXXWATRW-LBDFIVMYSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC=C(C=C1)CC(C)C)C(=O)O |
Computed by PubChem (NCBI)