Products 121702-86-1
CAS 121702-86-1 appears in our catalog under these names: (R)-Ibuprofen-d3, (R)-(-)-Ibuprofen-d3, >95% (HPLC), (R)–(–)–Ibuprofen–d3, (R)-(-)-Ibuprofen-d3, (R)-(-)-Ibuprofen-d3, 99.96%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 5mg, 1mg, 10mg, 50mg, 1 mg.
(2R)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 121702-86-1) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 209.30 g/mol. IUPAC name: (2R)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: HEFNNWSXXWATRW-NYJKMMONSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 209.30 g/mol |
| IUPAC name | (2R)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | HEFNNWSXXWATRW-NYJKMMONSA-N |
| SMILES | [2H]C([2H])([2H])[C@H](C1=CC=C(C=C1)CC(C)C)C(=O)O |
Computed by PubChem (NCBI)