Products 1329643-44-8
CAS 1329643-44-8 appears in our catalog under these names: (S)-Ibuprofen-d3, (S)-(+)-Ibuprofen-d3, >95% (HPLC), (S)-(+)-Ibuprofen D3, (S)–(+)–Ibuprofen D3, (S)-(+)-Ibuprofen-d3. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 5mg, 10mg, 2mg, 5 mg.
(2S)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid (CAS 1329643-44-8) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 209.30 g/mol. IUPAC name: (2S)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid. InChIKey: HEFNNWSXXWATRW-PCXQMPHHSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 209.30 g/mol |
| IUPAC name | (2S)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChIKey | HEFNNWSXXWATRW-PCXQMPHHSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C1=CC=C(C=C1)CC(C)C)C(=O)O |
Computed by PubChem (NCBI)