Products 1216503-21-7
CAS 1216503-21-7 appears in our catalog under these names: Nor Harmane-d7, >95% (HPLC), Norharman-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
1,3,4,5,6,7,8-heptadeuterio-9H-pyrido[3,4-b]indole (CAS 1216503-21-7) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 175.24 g/mol. IUPAC name: 1,3,4,5,6,7,8-heptadeuterio-9H-pyrido[3,4-b]indole. InChIKey: AIFRHYZBTHREPW-GSNKEKJESA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 175.24 g/mol |
| IUPAC name | 1,3,4,5,6,7,8-heptadeuterio-9H-pyrido[3,4-b]indole |
| InChIKey | AIFRHYZBTHREPW-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(N2)C(=NC(=C3[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Nor Harmane-d7, Norharman-d7