Products 1216505-29-1
CAS 1216505-29-1 appears in our catalog under these names: Ibuprofen Carboxylic Acid-d3 (Mixture of Diastereomers), Ibuprofen Carboxylic Acid-d3 (Mixture of Diastereomers), >95% (HPLC), Ibuprofen carboxylic acid-d3. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 50mg, 100mg, 1 mg.
3-[4-(1-carboxy-2,2,2-trideuterioethyl)phenyl]-2-methylpropanoic acid (CAS 1216505-29-1) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 239.28 g/mol. IUPAC name: 3-[4-(1-carboxy-2,2,2-trideuterioethyl)phenyl]-2-methylpropanoic acid. InChIKey: DIVLBIVDYADZPL-BMSJAHLVSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 239.28 g/mol |
| IUPAC name | 3-[4-(1-carboxy-2,2,2-trideuterioethyl)phenyl]-2-methylpropanoic acid |
| InChIKey | DIVLBIVDYADZPL-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=C(C=C1)CC(C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(4-(1-Carboxy(2,2,2-~2~H_3_)ethyl)phenyl)-2-methylpropanoic acid, 3-{4-[1-Carboxy(2,2,2-~2~H_3_)ethyl]phenyl}-2-methylpropanoic acid, Ibuprofen Carboxylic Acid-d3, 3-[4-(1-carboxy-2,2,2-trideuterioethyl)phenyl]-2-methylpropanoic acid, 3-{4-[1-carboxy(2,2,2-?H?)ethyl]phenyl}-2-methylpropanoic acid