Products 1216738-74-7
CAS 1216738-74-7 is the registry number for Difluoro(6-methoxypyridin-2-yl)acetic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2,2-difluoro-2-(6-methoxy-2-pyridinyl)acetic acid (CAS 1216738-74-7) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2,2-difluoro-2-(6-methoxy-2-pyridinyl)acetic acid. InChIKey: MIDCMWMUUZNNIQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2,2-difluoro-2-(6-methoxy-2-pyridinyl)acetic acid |
| InChIKey | MIDCMWMUUZNNIQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=N1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)