Products 1216767-04-2
CAS 1216767-04-2 appears in our catalog under these names: Tinidazole-d5, >95% (HPLC), Tinidazole-d5, D5-Tinidazole, D5-Tinidazole, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 1 mg, 1x10mg, 1x1ml.
2-methyl-5-nitro-1-[2-(1,1,2,2,2-pentadeuterioethylsulfonyl)ethyl]imidazole (CAS 1216767-04-2) is a chemical compound with the molecular formula C8H13N3O4S and a molecular weight of 252.30 g/mol. IUPAC name: 2-methyl-5-nitro-1-[2-(1,1,2,2,2-pentadeuterioethylsulfonyl)ethyl]imidazole. InChIKey: HJLSLZFTEKNLFI-WNWXXORZSA-N.
| Molecular formula | C8H13N3O4S |
|---|---|
| Molecular weight | 252.30 g/mol |
| IUPAC name | 2-methyl-5-nitro-1-[2-(1,1,2,2,2-pentadeuterioethylsulfonyl)ethyl]imidazole |
| InChIKey | HJLSLZFTEKNLFI-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])S(=O)(=O)CCN1C(=NC=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)