CAS 1431873-19-6 is the registry number for Ethyl 1-[(dimethylamino)sulfonyl]-1H-pyrazole-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl 1-(dimethylsulfamoyl)pyrazole-4-carboxylate (CAS 1431873-19-6) is a chemical compound with the molecular formula C8H13N3O4S and a molecular weight of 247.27 g/mol. IUPAC name: ethyl 1-(dimethylsulfamoyl)pyrazole-4-carboxylate. InChIKey: PGNMXGRQFSQNAU-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | ethyl 1-(dimethylsulfamoyl)pyrazole-4-carboxylate |
| InChIKey | PGNMXGRQFSQNAU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(N=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)