CAS 2551-73-7 appears in our catalog under these names: 1–Benzylguanidine hemisulfate, 1-Benzylguanidine hemisulfate, 1-Benzylguanidine hemisulfate 97%, N-Benzylguanidinecompound with sulfuric acid (2:1), 97%, 97%, 1-Benzylguanidine hemisulfate, 99%(HPLC),RG. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 25g.
2-benzylguanidine;sulfuric acid (CAS 2551-73-7) is a chemical compound with the molecular formula C8H13N3O4S and a molecular weight of 247.27 g/mol. IUPAC name: 2-benzylguanidine;sulfuric acid. InChIKey: XTNHCMPWHJGJIM-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 2-benzylguanidine;sulfuric acid |
| InChIKey | XTNHCMPWHJGJIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN=C(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)