CAS 1240526-74-2 appears in our catalog under these names: 3-(1,2-Dimethyl-1H-imidazole-4-sulfonamido)propanoic acid, 95%, 3-(1,2-Dimethyl-1H-imidazole-4-sulfonamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propanoic acid (CAS 1240526-74-2) is a chemical compound with the molecular formula C8H13N3O4S and a molecular weight of 247.27 g/mol. IUPAC name: 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propanoic acid. InChIKey: OQKWFFHPGWAWHW-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | 3-[(1,2-dimethylimidazol-4-yl)sulfonylamino]propanoic acid |
| InChIKey | OQKWFFHPGWAWHW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1C)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)