CAS 132253-58-8 is the registry number for Ethyl 1-(N,N-dimethylsulfamoyl)-1H-imidazole-4-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 1-(dimethylsulfamoyl)imidazole-4-carboxylate (CAS 132253-58-8) is a chemical compound with the molecular formula C8H13N3O4S and a molecular weight of 247.27 g/mol. IUPAC name: ethyl 1-(dimethylsulfamoyl)imidazole-4-carboxylate. InChIKey: IZEPURBGZDDOTQ-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O4S |
|---|---|
| Molecular weight | 247.27 g/mol |
| IUPAC name | ethyl 1-(dimethylsulfamoyl)imidazole-4-carboxylate |
| InChIKey | IZEPURBGZDDOTQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C=N1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)