CAS 1216889-99-4 is the registry number for 1,2,3,4-Tetrahydro-beta-carboline-13C,d2. Offered by: TRC. Available pack sizes: 5mg.
1,1-dideuterio-2,3,4,9-tetrahydro(213C)pyridino[3,4-b]indole (CAS 1216889-99-4) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 175.23 g/mol. IUPAC name: 1,1-dideuterio-2,3,4,9-tetrahydro(213C)pyridino[3,4-b]indole. InChIKey: CFTOTSJVQRFXOF-PCXFDFCJSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1,1-dideuterio-2,3,4,9-tetrahydro(213C)pyridino[3,4-b]indole |
| InChIKey | CFTOTSJVQRFXOF-PCXFDFCJSA-N |
| SMILES | [2H][13C]1(C2=C(CCN1)C3=CC=CC=C3N2)[2H] |
Computed by PubChem (NCBI)