CAS 1217-58-9 appears in our catalog under these names: 9H-Xanthen-9-ylacetic acid, 95%, 9H-xanthen-9-ylacetic acid, >95% (HPLC), 2-(9H-Xanthen-9-yl)acetic acid, 95+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 500mg, 50mg.
2-(9H-xanthen-9-yl)acetic acid (CAS 1217-58-9) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-(9H-xanthen-9-yl)acetic acid. InChIKey: WBWAHPQXFIMEOA-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-(9H-xanthen-9-yl)acetic acid |
| InChIKey | WBWAHPQXFIMEOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)CC(=O)O |
Computed by PubChem (NCBI)