CAS 1217031-87-2 appears in our catalog under these names: 1-(3-Chlorophenyl)cyclopropanamine hydrochloride, 97%, 1–(3–chlorophenyl)cyclopropan–1–amine hydrochloride, 1-(3-chlorophenyl)cyclopropanamine. hcl, [1-(3-chlorophenyl)cyclopropyl]amine hydrochloride, 95%, 95%. Offered by: AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1217031-87-2) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: AWQJBHOHCVILOR-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | AWQJBHOHCVILOR-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)