Products 1217360-63-8
CAS 1217360-63-8 appears in our catalog under these names: 2-(2-Iodophenyl-d4)-N,N-dimethylacetamide, >95% (HPLC), 2-(2-Iodophenyl)-N,N-dimethylacetamide-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 50 mg, 10 mg, 100 mg.
N,N-dimethyl-2-(2,3,4,5-tetradeuterio-6-iodophenyl)acetamide (CAS 1217360-63-8) is a chemical compound with the molecular formula C10H12INO and a molecular weight of 293.14 g/mol. IUPAC name: N,N-dimethyl-2-(2,3,4,5-tetradeuterio-6-iodophenyl)acetamide. InChIKey: BPDRJYYNQKBYBG-LNFUJOGGSA-N.
| Molecular formula | C10H12INO |
|---|---|
| Molecular weight | 293.14 g/mol |
| IUPAC name | N,N-dimethyl-2-(2,3,4,5-tetradeuterio-6-iodophenyl)acetamide |
| InChIKey | BPDRJYYNQKBYBG-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])CC(=O)N(C)C)I)[2H])[2H] |
Computed by PubChem (NCBI)