Products 1217446-30-4

CAS 1217446-30-4 is the registry number for (S)-tert-Butyl 3-ethylpiperazine-1-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl (3S)-3-ethylpiperazine-1-carboxylate;hydrochloride (CAS 1217446-30-4) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (3S)-3-ethylpiperazine-1-carboxylate;hydrochloride. InChIKey: NEAANDQXILMETG-FVGYRXGTSA-N.

Identity
Molecular formulaC11H23ClN2O2
Molecular weight250.76 g/mol
IUPAC nametert-butyl (3S)-3-ethylpiperazine-1-carboxylate;hydrochloride
InChIKeyNEAANDQXILMETG-FVGYRXGTSA-N
SMILESCC[C@H]1CN(CCN1)C(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)