CAS 1217464-96-4 appears in our catalog under these names: (R)-1-(5-Chloro-2-fluorophenyl)ethanamine hydrochloride, 95%, (1R)-1-(5-Chloro-2-fluorophenyl)ethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
(1R)-1-(5-chloro-2-fluorophenyl)ethanamine;hydrochloride (CAS 1217464-96-4) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1R)-1-(5-chloro-2-fluorophenyl)ethanamine;hydrochloride. InChIKey: ZJWNGZJNOWRDLV-NUBCRITNSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1R)-1-(5-chloro-2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | ZJWNGZJNOWRDLV-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)