CAS 1956371-30-4 appears in our catalog under these names: 1-(3-Chloro-2-fluorophenyl)ethanamine hydrochloride, 95%, 1–(3–Chloro–2–fluorophenyl)ethanamine hydrochloride, 1-(3-Chloro-2-fluorophenyl)ethanamine hydrochloride, 97%, 97%, 1-(3-CHLORO-2-FLUOROPHENYL)ETHANAMINE HCL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
1-(3-chloro-2-fluorophenyl)ethanamine;hydrochloride (CAS 1956371-30-4) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: 1-(3-chloro-2-fluorophenyl)ethanamine;hydrochloride. InChIKey: CEVBNFPEJNNLJJ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 1-(3-chloro-2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | CEVBNFPEJNNLJJ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)