CAS 1253790-80-5 appears in our catalog under these names: (R)-1-(4-Chloro-3-fluorophenyl)ethanamine hydrochloride, 95%, (R)-1-(4-Chloro-3-fluorophenyl)ethanamine hydrochloride 98%, (R)-1-(4-Chloro-3-fluorophenyl)ethanamine hydrochloride, 97%, 97%, (R)-1-(4-Chloro-3-fluorophenyl)ethanaminehydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g.
(1R)-1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride (CAS 1253790-80-5) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1R)-1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: SPEWNMFCSPYCCJ-NUBCRITNSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1R)-1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | SPEWNMFCSPYCCJ-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)