CAS 1000878-48-7 appears in our catalog under these names: (S)-1-(2-Chloro-6-fluorophenyl)ethanamine hydrochloride, 95%, (S)–1–(2–Chloro–6–fluorophenyl)ethanamine hydrochloride, (S)-1-(2-Chloro-6-Fluorophenyl)Ethanamine Hydrochloride, 98%, 98%, (S)-1-(2-Chloro-6-fluorophenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 50mg.
(1S)-1-(2-chloro-6-fluorophenyl)ethanamine;hydrochloride (CAS 1000878-48-7) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1S)-1-(2-chloro-6-fluorophenyl)ethanamine;hydrochloride. InChIKey: PUBRSCIMJQYMNY-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1S)-1-(2-chloro-6-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | PUBRSCIMJQYMNY-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1Cl)F)N.Cl |
Computed by PubChem (NCBI)