Products 1158252-31-3

CAS 1158252-31-3 is the registry number for N-(2-Chloro-6-fluorobenzyl)-n-methylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

1-(2-chloro-6-fluorophenyl)-N-methylmethanamine;hydrochloride (CAS 1158252-31-3) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: 1-(2-chloro-6-fluorophenyl)-N-methylmethanamine;hydrochloride. InChIKey: DMYONNCLZAOOHC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10Cl2FN
Molecular weight210.07 g/mol
IUPAC name1-(2-chloro-6-fluorophenyl)-N-methylmethanamine;hydrochloride
InChIKeyDMYONNCLZAOOHC-UHFFFAOYSA-N
SMILESCNCC1=C(C=CC=C1Cl)F.Cl

Computed by PubChem (NCBI)