Products 1217662-00-4
CAS 1217662-00-4 is the registry number for 1-(tert-Butyl) 2-methyl 2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-O-tert-butyl 2-O-methyl (2S)-2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 1217662-00-4) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: DIVMCYMKHUPYFL-AWEZNQCLSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-2,4,4-trimethyl-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | DIVMCYMKHUPYFL-AWEZNQCLSA-N |
| SMILES | C[C@]1(CC(C(=O)N1C(=O)OC(C)(C)C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)