CAS 1217695-90-3 is the registry number for Carbonic Acid 2,5-Dioxopyrrolidin-1-yl (S)-Tetrahydrofuran-d4-3-yl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2,5-dioxopyrrolidin-1-yl) [(3S)-2,2,5,5-tetradeuteriooxolan-3-yl] carbonate (CAS 1217695-90-3) is a chemical compound with the molecular formula C9H11NO6 and a molecular weight of 233.21 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) [(3S)-2,2,5,5-tetradeuteriooxolan-3-yl] carbonate. InChIKey: SAWUNSFFYCOVPE-NVPUURGMSA-N.
| Molecular formula | C9H11NO6 |
|---|---|
| Molecular weight | 233.21 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) [(3S)-2,2,5,5-tetradeuteriooxolan-3-yl] carbonate |
| InChIKey | SAWUNSFFYCOVPE-NVPUURGMSA-N |
| SMILES | [2H]C1(C[C@@H](C(O1)([2H])[2H])OC(=O)ON2C(=O)CCC2=O)[2H] |
Computed by PubChem (NCBI)