CAS 855740-52-2 appears in our catalog under these names: Dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate hydrate, 98%, Dimethyl 4–Hydroxy–2，6–pyridinedicarboxylate Monohydrate, Dimethyl 4-Hydroxy-2,6-pyridinedicarboxylate Monohydrate, >98.0%(GC), Dimethyl 4-Hydroxy-2,6-pyridinedicarboxylate Monohydrate, 98.0%, 98.0%, 2,6-dimethyl 4-oxo-1,4-dihydropyridine-2,6-dicarboxylate hydrate, 98%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 200mg, 250mg.
Dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate;hydrate (CAS 855740-52-2) is a chemical compound with the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. IUPAC name: dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate;hydrate. InChIKey: VEFAAISLTBOWAY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO6 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | dimethyl 4-oxo-1H-pyridine-2,6-dicarboxylate;hydrate |
| InChIKey | VEFAAISLTBOWAY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C=C(N1)C(=O)OC.O |
Computed by PubChem (NCBI)