Products 23468-99-7

CAS 23468-99-7 is the registry number for 4-Hydroxy-3,5-isoxazoledicarboxylic Acid 3,5-Diethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

Diethyl 4-hydroxy-1,2-oxazole-3,5-dicarboxylate (CAS 23468-99-7) is a chemical compound with the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. IUPAC name: diethyl 4-hydroxy-1,2-oxazole-3,5-dicarboxylate. InChIKey: VQAPFTIVWFDRCE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO6
Molecular weight229.19 g/mol
IUPAC namediethyl 4-hydroxy-1,2-oxazole-3,5-dicarboxylate
InChIKeyVQAPFTIVWFDRCE-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=NO1)C(=O)OCC)O

Computed by PubChem (NCBI)