Products 1428131-72-9

CAS 1428131-72-9 is the registry number for Malonic acid 2,5-dioxo-pyrrolidin-1-yl ester ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl propanedioate (CAS 1428131-72-9) is a chemical compound with the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. IUPAC name: 3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl propanedioate. InChIKey: XXARCHBTNULQNM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO6
Molecular weight229.19 g/mol
IUPAC name3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl propanedioate
InChIKeyXXARCHBTNULQNM-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)