Products 2580942-98-7
CAS 2580942-98-7 is the registry number for 4-(L-Alanin-3-yl)-2-hydroxy-cis,cis-muconate 6-semialdehyde. Offered by: MedChemExpress. Available pack sizes: Get quote.
(6S)-6-amino-4-(2-hydroxyethenyl)-2-oxohept-3-enedioic acid (CAS 2580942-98-7) is a chemical compound with the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. IUPAC name: (6S)-6-amino-4-(2-hydroxyethenyl)-2-oxohept-3-enedioic acid. InChIKey: PIYTUGMLAKPQKI-LURJTMIESA-N.
| Molecular formula | C9H11NO6 |
|---|---|
| Molecular weight | 229.19 g/mol |
| IUPAC name | (6S)-6-amino-4-(2-hydroxyethenyl)-2-oxohept-3-enedioic acid |
| InChIKey | PIYTUGMLAKPQKI-LURJTMIESA-N |
| SMILES | C([C@@H](C(=O)O)N)C(=CC(=O)C(=O)O)C=CO |
Computed by PubChem (NCBI)